Products 886767-69-7
CAS 886767-69-7 appears in our catalog under these names: tert-Butyl 3-(4-bromophenyl)piperazine-1-carboxylate, 95%, tert–Butyl 3–(4–bromophenyl)piperazine–1–carboxylate, tert-Butyl 3-(4-bromophenyl)piperazine-1-carboxylate. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl 3-(4-bromophenyl)piperazine-1-carboxylate (CAS 886767-69-7) is a chemical compound with the molecular formula C15H21BrN2O2 and a molecular weight of 341.24 g/mol. IUPAC name: tert-butyl 3-(4-bromophenyl)piperazine-1-carboxylate. InChIKey: DTXBJGIIRFTGFW-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2O2 |
|---|---|
| Molecular weight | 341.24 g/mol |
| IUPAC name | tert-butyl 3-(4-bromophenyl)piperazine-1-carboxylate |
| InChIKey | DTXBJGIIRFTGFW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)