Products 2206609-16-5
CAS 2206609-16-5 is the registry number for 5'-Bromo-3,4,5,6-tetrahydro-2h-[1,2']bipyridinyl-3'-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 5-bromo-2-piperidin-1-ylpyridine-3-carboxylate (CAS 2206609-16-5) is a chemical compound with the molecular formula C15H21BrN2O2 and a molecular weight of 341.24 g/mol. IUPAC name: tert-butyl 5-bromo-2-piperidin-1-ylpyridine-3-carboxylate. InChIKey: VUPBSEIUWNVQKP-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2O2 |
|---|---|
| Molecular weight | 341.24 g/mol |
| IUPAC name | tert-butyl 5-bromo-2-piperidin-1-ylpyridine-3-carboxylate |
| InChIKey | VUPBSEIUWNVQKP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(N=CC(=C1)Br)N2CCCCC2 |
Computed by PubChem (NCBI)