Products 1799310-76-1

CAS 1799310-76-1 is the registry number for 1-Methylazetidine-3-sulfonyl chloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

1-methylazetidine-3-sulfonyl chloride (CAS 1799310-76-1) is a chemical compound with the molecular formula C4H8ClNO2S and a molecular weight of 169.63 g/mol. IUPAC name: 1-methylazetidine-3-sulfonyl chloride. InChIKey: VVIMYAWTFZOMKS-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8ClNO2S
Molecular weight169.63 g/mol
IUPAC name1-methylazetidine-3-sulfonyl chloride
InChIKeyVVIMYAWTFZOMKS-UHFFFAOYSA-N
SMILESCN1CC(C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)