CAS 2566444-22-0 appears in our catalog under these names: (R)-3-Amino-2,3-dihydrothiophene 1,1-dioxide hydrochloride, 97%, 97%, (R)-3-Amino-2,3-dihydrothiophene 1,1-dioxide hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(3R)-1,1-dioxo-2,3-dihydrothiophen-3-amine;hydrochloride (CAS 2566444-22-0) is a chemical compound with the molecular formula C4H8ClNO2S and a molecular weight of 169.63 g/mol. IUPAC name: (3R)-1,1-dioxo-2,3-dihydrothiophen-3-amine;hydrochloride. InChIKey: LKFDPRBLUFZFJH-PGMHMLKASA-N.
| Molecular formula | C4H8ClNO2S |
|---|---|
| Molecular weight | 169.63 g/mol |
| IUPAC name | (3R)-1,1-dioxo-2,3-dihydrothiophen-3-amine;hydrochloride |
| InChIKey | LKFDPRBLUFZFJH-PGMHMLKASA-N |
| SMILES | C1[C@@H](C=CS1(=O)=O)N.Cl |
Computed by PubChem (NCBI)