Products 2306275-97-6

CAS 2306275-97-6 is the registry number for 3-aminothietane-3-carboxylic acid hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

3-aminothietane-3-carboxylic acid;hydrochloride (CAS 2306275-97-6) is a chemical compound with the molecular formula C4H8ClNO2S and a molecular weight of 169.63 g/mol. IUPAC name: 3-aminothietane-3-carboxylic acid;hydrochloride. InChIKey: QSQCWGYPGCBEFM-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8ClNO2S
Molecular weight169.63 g/mol
IUPAC name3-aminothietane-3-carboxylic acid;hydrochloride
InChIKeyQSQCWGYPGCBEFM-UHFFFAOYSA-N
SMILESC1C(CS1)(C(=O)O)N.Cl

Computed by PubChem (NCBI)