Products 1799434-47-1
CAS 1799434-47-1 is the registry number for 2-Methoxy-4-(5-(pyridin-4-yl)-1h-benzo[d]imidazol-1-yl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
2-methoxy-4-(5-pyridin-4-ylbenzimidazol-1-yl)phenol (CAS 1799434-47-1) is a chemical compound with the molecular formula C19H15N3O2 and a molecular weight of 317.3 g/mol. IUPAC name: 2-methoxy-4-(5-pyridin-4-ylbenzimidazol-1-yl)phenol. InChIKey: WREPXAGGXIQFCZ-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O2 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 2-methoxy-4-(5-pyridin-4-ylbenzimidazol-1-yl)phenol |
| InChIKey | WREPXAGGXIQFCZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2C=NC3=C2C=CC(=C3)C4=CC=NC=C4)O |
Computed by PubChem (NCBI)