Products 708987-61-5
CAS 708987-61-5 is the registry number for N-(1H-Indol-5-yl)-5-methyl-3-phenylisoxazole-4-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1H-indol-5-yl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide (CAS 708987-61-5) is a chemical compound with the molecular formula C19H15N3O2 and a molecular weight of 317.3 g/mol. IUPAC name: N-(1H-indol-5-yl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide. InChIKey: TZDXPFCHLMYIIN-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O2 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | N-(1H-indol-5-yl)-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
| InChIKey | TZDXPFCHLMYIIN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)NC3=CC4=C(C=C3)NC=C4 |
Computed by PubChem (NCBI)