Products 2097497-16-8
CAS 2097497-16-8 is the registry number for Anticancer agent 109. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3Z)-5-hydroxy-4,6-dimethyl-3-(quinolin-2-ylmethylidene)-1H-pyrrolo[2,3-b]pyridin-2-one (CAS 2097497-16-8) is a chemical compound with the molecular formula C19H15N3O2 and a molecular weight of 317.3 g/mol. IUPAC name: (3Z)-5-hydroxy-4,6-dimethyl-3-(quinolin-2-ylmethylidene)-1H-pyrrolo[2,3-b]pyridin-2-one. InChIKey: CSKXBCHNPARCGH-ZROIWOOFSA-N.
| Molecular formula | C19H15N3O2 |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | (3Z)-5-hydroxy-4,6-dimethyl-3-(quinolin-2-ylmethylidene)-1H-pyrrolo[2,3-b]pyridin-2-one |
| InChIKey | CSKXBCHNPARCGH-ZROIWOOFSA-N |
| SMILES | CC1=C2/C(=C/C3=NC4=CC=CC=C4C=C3)/C(=O)NC2=NC(=C1O)C |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 109, orb2567011