Products 1799753-63-1
CAS 1799753-63-1 is the registry number for BAY-876. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
3-[3-(5-benzyl-2-carbamoylphenyl)phenyl]-2-methylpropanoic acid (CAS 1799753-63-1) is a chemical compound with the molecular formula C24H23NO3 and a molecular weight of 373.4 g/mol. IUPAC name: 3-[3-(5-benzyl-2-carbamoylphenyl)phenyl]-2-methylpropanoic acid. InChIKey: PXRCDPVYRPKGGI-UHFFFAOYSA-N.
| Molecular formula | C24H23NO3 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 3-[3-(5-benzyl-2-carbamoylphenyl)phenyl]-2-methylpropanoic acid |
| InChIKey | PXRCDPVYRPKGGI-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=CC=C1)C2=C(C=CC(=C2)CC3=CC=CC=C3)C(=O)N)C(=O)O |
Computed by PubChem (NCBI)