Products 340168-99-2

CAS 340168-99-2 is the registry number for N,N-Bis((s)-1-phenylethyl)phthalamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-[bis[(1S)-1-phenylethyl]carbamoyl]benzoic acid (CAS 340168-99-2) is a chemical compound with the molecular formula C24H23NO3 and a molecular weight of 373.4 g/mol. IUPAC name: 2-[bis[(1S)-1-phenylethyl]carbamoyl]benzoic acid. InChIKey: NCYIVOVUPRJYNJ-ROUUACIJSA-N.

Identity
Molecular formulaC24H23NO3
Molecular weight373.4 g/mol
IUPAC name2-[bis[(1S)-1-phenylethyl]carbamoyl]benzoic acid
InChIKeyNCYIVOVUPRJYNJ-ROUUACIJSA-N
SMILESC[C@@H](C1=CC=CC=C1)N([C@@H](C)C2=CC=CC=C2)C(=O)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)