CAS 20206-19-3 appears in our catalog under these names: 1,3-Dihydro-3,3-bis(4-hydroxy-3,5-dimethylphenyl)-2h-indol-2-one, 95%, 3,3-Bis-(3,5-dimethyl-4-hydroxyphenyl)-1,3-dihydro-indol-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg, 2000mg.
3,3-bis(4-hydroxy-3,5-dimethylphenyl)-1H-indol-2-one (CAS 20206-19-3) is a chemical compound with the molecular formula C24H23NO3 and a molecular weight of 373.4 g/mol. IUPAC name: 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-1H-indol-2-one. InChIKey: ZPHKSRYNIAWSIS-UHFFFAOYSA-N.
| Molecular formula | C24H23NO3 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 3,3-bis(4-hydroxy-3,5-dimethylphenyl)-1H-indol-2-one |
| InChIKey | ZPHKSRYNIAWSIS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)C2(C3=CC=CC=C3NC2=O)C4=CC(=C(C(=C4)C)O)C |
Computed by PubChem (NCBI)