Products 1251741-03-3
CAS 1251741-03-3 is the registry number for Di-desfluoro Ezetimibe. Offered by: TRC. Available pack sizes: 250mg.
(3R,4S)-4-(4-hydroxyphenyl)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1-phenylazetidin-2-one (CAS 1251741-03-3) is a chemical compound with the molecular formula C24H23NO3 and a molecular weight of 373.4 g/mol. IUPAC name: (3R,4S)-4-(4-hydroxyphenyl)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1-phenylazetidin-2-one. InChIKey: IJEWIYYVWUMFCU-XPWALMASSA-N.
| Molecular formula | C24H23NO3 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | (3R,4S)-4-(4-hydroxyphenyl)-3-[(3S)-3-hydroxy-3-phenylpropyl]-1-phenylazetidin-2-one |
| InChIKey | IJEWIYYVWUMFCU-XPWALMASSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CC[C@@H]2[C@H](N(C2=O)C3=CC=CC=C3)C4=CC=C(C=C4)O)O |
Computed by PubChem (NCBI)
Synonyms:
Di-desfluoro Ezetimibe, Ezetimibe Impurity J