CAS 1799811-92-9 appears in our catalog under these names: (5R)-6-[(tert-butoxy)carbonyl]-6-azaspiro[2.5]octane-5-carboxylic acid, 97%, 97%, (5R)-6-[(TERT-BUTOXY)CARBONYL]-6-AZASPIRO[2.5]OCTANE-5-CARBOXYLIC ACID, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
(7R)-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octane-7-carboxylic acid (CAS 1799811-92-9) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (7R)-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octane-7-carboxylic acid. InChIKey: PJVQCWIKEOHTOE-SECBINFHSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (7R)-6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[2.5]octane-7-carboxylic acid |
| InChIKey | PJVQCWIKEOHTOE-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC2)C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)