Products 1799902-25-2
CAS 1799902-25-2 is the registry number for Methyl 4-(3-hydroxy-3-phenyl-1-butyn-1-yl)benzoate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-(3-hydroxy-3-phenylbut-1-ynyl)benzoate (CAS 1799902-25-2) is a chemical compound with the molecular formula C18H16O3 and a molecular weight of 280.3 g/mol. IUPAC name: methyl 4-(3-hydroxy-3-phenylbut-1-ynyl)benzoate. InChIKey: DJSWTKDJUMLQAO-UHFFFAOYSA-N.
| Molecular formula | C18H16O3 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | methyl 4-(3-hydroxy-3-phenylbut-1-ynyl)benzoate |
| InChIKey | DJSWTKDJUMLQAO-UHFFFAOYSA-N |
| SMILES | CC(C#CC1=CC=C(C=C1)C(=O)OC)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)