CAS 314742-78-4 is the registry number for 3-Benzyl-7-hydroxy-4,8-dimethyl-2h-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-benzyl-7-hydroxy-4,8-dimethylchromen-2-one (CAS 314742-78-4) is a chemical compound with the molecular formula C18H16O3 and a molecular weight of 280.3 g/mol. IUPAC name: 3-benzyl-7-hydroxy-4,8-dimethylchromen-2-one. InChIKey: IGUFQLSMJINTKY-UHFFFAOYSA-N.
| Molecular formula | C18H16O3 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | 3-benzyl-7-hydroxy-4,8-dimethylchromen-2-one |
| InChIKey | IGUFQLSMJINTKY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2C)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)