CAS 5999-27-9 is the registry number for (R)-Phenprocoumon. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-3-[(1R)-1-phenylpropyl]chromen-2-one (CAS 5999-27-9) is a chemical compound with the molecular formula C18H16O3 and a molecular weight of 280.3 g/mol. IUPAC name: 4-hydroxy-3-[(1R)-1-phenylpropyl]chromen-2-one. InChIKey: DQDAYGNAKTZFIW-CYBMUJFWSA-N.
| Molecular formula | C18H16O3 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | 4-hydroxy-3-[(1R)-1-phenylpropyl]chromen-2-one |
| InChIKey | DQDAYGNAKTZFIW-CYBMUJFWSA-N |
| SMILES | CC[C@H](C1=CC=CC=C1)C2=C(C3=CC=CC=C3OC2=O)O |
Computed by PubChem (NCBI)