CAS 3343-80-4 appears in our catalog under these names: Benzbromarone Impurity 7, 2-Ethylbenzofuran-3-yl p-Methoxyphenyl Ketone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(2-ethyl-1-benzofuran-3-yl)-(4-methoxyphenyl)methanone (CAS 3343-80-4) is a chemical compound with the molecular formula C18H16O3 and a molecular weight of 280.3 g/mol. IUPAC name: (2-ethyl-1-benzofuran-3-yl)-(4-methoxyphenyl)methanone. InChIKey: TTXQKBMNVDJBPZ-UHFFFAOYSA-N.
| Molecular formula | C18H16O3 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | (2-ethyl-1-benzofuran-3-yl)-(4-methoxyphenyl)methanone |
| InChIKey | TTXQKBMNVDJBPZ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)