Products 180127-82-6
CAS 180127-82-6 is the registry number for 1-(4-(tert-butyl)benzyl)-1H-benzo[d]imidazole, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
1-[(4-tert-butylphenyl)methyl]benzimidazole (CAS 180127-82-6) is a chemical compound with the molecular formula C18H20N2 and a molecular weight of 264.4 g/mol. IUPAC name: 1-[(4-tert-butylphenyl)methyl]benzimidazole. InChIKey: VWVWAUJWFFKPEM-UHFFFAOYSA-N.
| Molecular formula | C18H20N2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 1-[(4-tert-butylphenyl)methyl]benzimidazole |
| InChIKey | VWVWAUJWFFKPEM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CN2C=NC3=CC=CC=C32 |
Computed by PubChem (NCBI)