Products 1801851-87-5
CAS 1801851-87-5 appears in our catalog under these names: (S)–Indoximod–d3, 1-Methyl-d3-L-tryptophan, 99 atom % D, min 98% Chemical Purity, (S)-Indoximod-d3, 99.0%. Offered by: GLPBio, CDN, MedChemExpress. Available pack sizes: 5mg, 0,05g, 0,01g, 10mg, 10 mg, 5 mg, 1 mg.
(2S)-2-amino-3-[1-(trideuteriomethyl)indol-3-yl]propanoic acid (CAS 1801851-87-5) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 221.27 g/mol. IUPAC name: (2S)-2-amino-3-[1-(trideuteriomethyl)indol-3-yl]propanoic acid. InChIKey: ZADWXFSZEAPBJS-ASGODXDTSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 221.27 g/mol |
| IUPAC name | (2S)-2-amino-3-[1-(trideuteriomethyl)indol-3-yl]propanoic acid |
| InChIKey | ZADWXFSZEAPBJS-ASGODXDTSA-N |
| SMILES | [2H]C([2H])([2H])N1C=C(C2=CC=CC=C21)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)