Products 1801923-68-1
CAS 1801923-68-1 is the registry number for 2,2''-Dimethoxy-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-carboxy-2-methoxyphenyl)phenyl]-3-methoxybenzoic acid (CAS 1801923-68-1) is a chemical compound with the molecular formula C22H18O6 and a molecular weight of 378.4 g/mol. IUPAC name: 4-[4-(4-carboxy-2-methoxyphenyl)phenyl]-3-methoxybenzoic acid. InChIKey: DNBGOEITWAHAES-UHFFFAOYSA-N.
| Molecular formula | C22H18O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 4-[4-(4-carboxy-2-methoxyphenyl)phenyl]-3-methoxybenzoic acid |
| InChIKey | DNBGOEITWAHAES-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)C2=CC=C(C=C2)C3=C(C=C(C=C3)C(=O)O)OC |
Computed by PubChem (NCBI)