Products 1392416-19-1
CAS 1392416-19-1 appears in our catalog under these names: 2',5'–Dimethoxy–(1,1'：4',1''–terphenyl)–4,4''–dicarboxylic acid, 2',5'-Dimethoxy-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid 95%, 2',5'-Dimethoxy-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 95%, 95%, 2',5'-Dimethoxy-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-[4-(4-carboxyphenyl)-2,5-dimethoxyphenyl]benzoic acid (CAS 1392416-19-1) is a chemical compound with the molecular formula C22H18O6 and a molecular weight of 378.4 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)-2,5-dimethoxyphenyl]benzoic acid. InChIKey: GUIDAAAVTIRHLQ-UHFFFAOYSA-N.
| Molecular formula | C22H18O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)-2,5-dimethoxyphenyl]benzoic acid |
| InChIKey | GUIDAAAVTIRHLQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C2=CC=C(C=C2)C(=O)O)OC)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)