Products 47593-50-0

CAS 47593-50-0 is the registry number for 4,4'-((1,4-Phenylenebis(methylene))bis(oxy))dibenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[[4-[(4-carboxyphenoxy)methyl]phenyl]methoxy]benzoic acid (CAS 47593-50-0) is a chemical compound with the molecular formula C22H18O6 and a molecular weight of 378.4 g/mol. IUPAC name: 4-[[4-[(4-carboxyphenoxy)methyl]phenyl]methoxy]benzoic acid. InChIKey: AYEXKJKXZHOWPW-UHFFFAOYSA-N.

Identity
Molecular formulaC22H18O6
Molecular weight378.4 g/mol
IUPAC name4-[[4-[(4-carboxyphenoxy)methyl]phenyl]methoxy]benzoic acid
InChIKeyAYEXKJKXZHOWPW-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1COC2=CC=C(C=C2)C(=O)O)COC3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)