CAS 2249752-02-9 is the registry number for 2',5'-Bis(hydroxymethyl)-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-carboxyphenyl)-2,5-bis(hydroxymethyl)phenyl]benzoic acid (CAS 2249752-02-9) is a chemical compound with the molecular formula C22H18O6 and a molecular weight of 378.4 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)-2,5-bis(hydroxymethyl)phenyl]benzoic acid. InChIKey: VYKFROHBQSMAFK-UHFFFAOYSA-N.
| Molecular formula | C22H18O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)-2,5-bis(hydroxymethyl)phenyl]benzoic acid |
| InChIKey | VYKFROHBQSMAFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2CO)C3=CC=C(C=C3)C(=O)O)CO)C(=O)O |
Computed by PubChem (NCBI)