CAS 1802079-06-6 is the registry number for (S)-4-Benzyl-3-(3-(2,3-dihydro-1H-inden-2-yl)propanoyl)oxazolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-benzyl-3-[3-(2,3-dihydro-1H-inden-2-yl)propanoyl]-1,3-oxazolidin-2-one (CAS 1802079-06-6) is a chemical compound with the molecular formula C22H23NO3 and a molecular weight of 349.4 g/mol. IUPAC name: (4S)-4-benzyl-3-[3-(2,3-dihydro-1H-inden-2-yl)propanoyl]-1,3-oxazolidin-2-one. InChIKey: YVNNYFWPDMFDOK-FQEVSTJZSA-N.
| Molecular formula | C22H23NO3 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (4S)-4-benzyl-3-[3-(2,3-dihydro-1H-inden-2-yl)propanoyl]-1,3-oxazolidin-2-one |
| InChIKey | YVNNYFWPDMFDOK-FQEVSTJZSA-N |
| SMILES | C1[C@@H](N(C(=O)O1)C(=O)CCC2CC3=CC=CC=C3C2)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)