CAS 937604-76-7 is the registry number for 4-(4-(tert-Butyl)phenyl)-2-indol-3-yl-4-oxobutanoic acid. Offered by: Biosynth. Available pack sizes: 5000mg.
4-(4-tert-butylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid (CAS 937604-76-7) is a chemical compound with the molecular formula C22H23NO3 and a molecular weight of 349.4 g/mol. IUPAC name: 4-(4-tert-butylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid. InChIKey: XBFFWUXQRIRPCQ-UHFFFAOYSA-N.
| Molecular formula | C22H23NO3 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 4-(4-tert-butylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid |
| InChIKey | XBFFWUXQRIRPCQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)CC(C2=CNC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)