CAS 932841-33-3 appears in our catalog under these names: 2-(3-Butoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid, 95%, 2-(3-Butoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3-butoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid (CAS 932841-33-3) is a chemical compound with the molecular formula C22H23NO3 and a molecular weight of 349.4 g/mol. IUPAC name: 2-(3-butoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid. InChIKey: NLWQQBSQOWCJFH-UHFFFAOYSA-N.
| Molecular formula | C22H23NO3 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 2-(3-butoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid |
| InChIKey | NLWQQBSQOWCJFH-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=CC(=C1)C2=NC3=C(C=C(C=C3C(=C2)C(=O)O)C)C |
Computed by PubChem (NCBI)