CAS 18028-57-4 appears in our catalog under these names: 6-Methoxy-1,4-dimethyl-9h-carbazole, 95%, 6-Methoxy-1,4-dimethyl-9H-carbazole, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
6-methoxy-1,4-dimethyl-9H-carbazole (CAS 18028-57-4) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: 6-methoxy-1,4-dimethyl-9H-carbazole. InChIKey: JYCYJKQLGQKTRX-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | 6-methoxy-1,4-dimethyl-9H-carbazole |
| InChIKey | JYCYJKQLGQKTRX-UHFFFAOYSA-N |
| SMILES | CC1=C2C3=C(C=CC(=C3)OC)NC2=C(C=C1)C |
Computed by PubChem (NCBI)