CAS 1802848-94-7 appears in our catalog under these names: ABBV-318, 98%, ABBV-318/ 99.61% (existing batch purity), ABBV–318, ABBV-318, 98%, 98%, ABBV-318, 98.72%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 1mg, 5mg, 25mg, 50mg, 500mg, 10 mg.
[(3R)-3-fluoropyrrolidin-1-yl]-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinolin-2-yl]methanone (CAS 1802848-94-7) is a chemical compound with the molecular formula C20H15F4N3O2 and a molecular weight of 405.3 g/mol. IUPAC name: [(3R)-3-fluoropyrrolidin-1-yl]-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinolin-2-yl]methanone. InChIKey: FWLFRXVPNVBXGR-CQSZACIVSA-N.
| Molecular formula | C20H15F4N3O2 |
|---|---|
| Molecular weight | 405.3 g/mol |
| IUPAC name | [(3R)-3-fluoropyrrolidin-1-yl]-[6-[[5-(trifluoromethyl)-2-pyridinyl]oxy]quinolin-2-yl]methanone |
| InChIKey | FWLFRXVPNVBXGR-CQSZACIVSA-N |
| SMILES | C1CN(C[C@@H]1F)C(=O)C2=NC3=C(C=C2)C=C(C=C3)OC4=NC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)