CAS 2031161-54-1 appears in our catalog under these names: (R)-UT-155, 98%, (R)-UT-155, 98.35%, 98.35%, (R)-UT-155, 98.09%. Offered by: AmBeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 5 mg, 10mM/1mL, 25 mg, 50 mg.
(2R)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(5-fluoroindol-1-yl)-2-hydroxy-2-methylpropanamide (CAS 2031161-54-1) is a chemical compound with the molecular formula C20H15F4N3O2 and a molecular weight of 405.3 g/mol. IUPAC name: (2R)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(5-fluoroindol-1-yl)-2-hydroxy-2-methylpropanamide. InChIKey: CFSAYQVTXBMPRF-LJQANCHMSA-N.
| Molecular formula | C20H15F4N3O2 |
|---|---|
| Molecular weight | 405.3 g/mol |
| IUPAC name | (2R)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(5-fluoroindol-1-yl)-2-hydroxy-2-methylpropanamide |
| InChIKey | CFSAYQVTXBMPRF-LJQANCHMSA-N |
| SMILES | C[C@@](CN1C=CC2=C1C=CC(=C2)F)(C(=O)NC3=CC(=C(C=C3)C#N)C(F)(F)F)O |
Computed by PubChem (NCBI)