CAS 2031161-35-8 appears in our catalog under these names: UT-155, 99.39%, UT-155/ 99.63% (existing batch purity), UT–155, UT-155, UT-155 99.39%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
(2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(5-fluoroindol-1-yl)-2-hydroxy-2-methylpropanamide (CAS 2031161-35-8) is a chemical compound with the molecular formula C20H15F4N3O2 and a molecular weight of 405.3 g/mol. IUPAC name: (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(5-fluoroindol-1-yl)-2-hydroxy-2-methylpropanamide. InChIKey: CFSAYQVTXBMPRF-IBGZPJMESA-N.
| Molecular formula | C20H15F4N3O2 |
|---|---|
| Molecular weight | 405.3 g/mol |
| IUPAC name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(5-fluoroindol-1-yl)-2-hydroxy-2-methylpropanamide |
| InChIKey | CFSAYQVTXBMPRF-IBGZPJMESA-N |
| SMILES | C[C@](CN1C=CC2=C1C=CC(=C2)F)(C(=O)NC3=CC(=C(C=C3)C#N)C(F)(F)F)O |
Computed by PubChem (NCBI)