CAS 1803097-13-3 is the registry number for 2,2,2-Trifluoro-N-(4-nitrobenzyl)-1-phenylethan-1-imine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-N-[(4-nitrophenyl)methyl]-1-phenylethanimine (CAS 1803097-13-3) is a chemical compound with the molecular formula C15H11F3N2O2 and a molecular weight of 308.25 g/mol. IUPAC name: 2,2,2-trifluoro-N-[(4-nitrophenyl)methyl]-1-phenylethanimine. InChIKey: LSYWPISADYIOIC-UHFFFAOYSA-N.
| Molecular formula | C15H11F3N2O2 |
|---|---|
| Molecular weight | 308.25 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[(4-nitrophenyl)methyl]-1-phenylethanimine |
| InChIKey | LSYWPISADYIOIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=NCC2=CC=C(C=C2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)