CAS 895065-27-7 is the registry number for N-(3-(Trifluoroacetamido)phenyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
N-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide (CAS 895065-27-7) is a chemical compound with the molecular formula C15H11F3N2O2 and a molecular weight of 308.25 g/mol. IUPAC name: N-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide. InChIKey: VNVSVSNSYCLZRO-UHFFFAOYSA-N.
| Molecular formula | C15H11F3N2O2 |
|---|---|
| Molecular weight | 308.25 g/mol |
| IUPAC name | N-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide |
| InChIKey | VNVSVSNSYCLZRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC(=CC=C2)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)