CAS 861412-92-2 is the registry number for 4-(4-Cyclopropyl-6-trifluoromethyl-pyrimidin-2-yloxy)-benzaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]oxybenzaldehyde (CAS 861412-92-2) is a chemical compound with the molecular formula C15H11F3N2O2 and a molecular weight of 308.25 g/mol. IUPAC name: 4-[4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]oxybenzaldehyde. InChIKey: SSUQMELIGAJBJX-UHFFFAOYSA-N.
| Molecular formula | C15H11F3N2O2 |
|---|---|
| Molecular weight | 308.25 g/mol |
| IUPAC name | 4-[4-cyclopropyl-6-(trifluoromethyl)pyrimidin-2-yl]oxybenzaldehyde |
| InChIKey | SSUQMELIGAJBJX-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=NC(=N2)OC3=CC=C(C=C3)C=O)C(F)(F)F |
Computed by PubChem (NCBI)