Products 1803581-54-5

CAS 1803581-54-5 is the registry number for 4-(Methoxymethyl)piperidine-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(methoxymethyl)piperidine-4-carboxylic acid;hydrochloride (CAS 1803581-54-5) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: 4-(methoxymethyl)piperidine-4-carboxylic acid;hydrochloride. InChIKey: FRYPUPXUYROTHD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO3
Molecular weight209.67 g/mol
IUPAC name4-(methoxymethyl)piperidine-4-carboxylic acid;hydrochloride
InChIKeyFRYPUPXUYROTHD-UHFFFAOYSA-N
SMILESCOCC1(CCNCC1)C(=O)O.Cl

Computed by PubChem (NCBI)