Products 1803583-30-3
CAS 1803583-30-3 is the registry number for 4-{7H-Pyrrolo(2,3-d)pyrimidin-4-yl}-1H-pyrazole hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(1H-pyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidine;hydrochloride (CAS 1803583-30-3) is a chemical compound with the molecular formula C9H8ClN5 and a molecular weight of 221.64 g/mol. IUPAC name: 4-(1H-pyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidine;hydrochloride. InChIKey: UAGNANZPOYXWNH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN5 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 4-(1H-pyrazol-4-yl)-7H-pyrrolo[2,3-d]pyrimidine;hydrochloride |
| InChIKey | UAGNANZPOYXWNH-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=NC(=C21)C3=CNN=C3.Cl |
Computed by PubChem (NCBI)