CAS 29366-77-6 appears in our catalog under these names: Irsogladine Impurity 3, 6-(2-Chlorophenyl)-1,3,5-triazine-2,4-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(2-chlorophenyl)-1,3,5-triazine-2,4-diamine (CAS 29366-77-6) is a chemical compound with the molecular formula C9H8ClN5 and a molecular weight of 221.64 g/mol. IUPAC name: 6-(2-chlorophenyl)-1,3,5-triazine-2,4-diamine. InChIKey: RDRNLYCDZBVQKZ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN5 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 6-(2-chlorophenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | RDRNLYCDZBVQKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NC(=N2)N)N)Cl |
Computed by PubChem (NCBI)