CAS 4514-54-9 appears in our catalog under these names: Irsogladine Impurity 4, Irsogladine Impurity 10. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
6-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine (CAS 4514-54-9) is a chemical compound with the molecular formula C9H8ClN5 and a molecular weight of 221.64 g/mol. IUPAC name: 6-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine. InChIKey: QBLXLPLVBAYDMX-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN5 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 6-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | QBLXLPLVBAYDMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=NC(=N2)N)N |
Computed by PubChem (NCBI)