CAS 1803584-36-2 appears in our catalog under these names: Benzyl 3-amino-2-phenylpropanoate hydrochloride, Benzyl 3-amino-2-phenylpropanoate hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
Benzyl 3-amino-2-phenylpropanoate;hydrochloride (CAS 1803584-36-2) is a chemical compound with the molecular formula C16H18ClNO2 and a molecular weight of 291.77 g/mol. IUPAC name: benzyl 3-amino-2-phenylpropanoate;hydrochloride. InChIKey: JJJARRYOIJJCTH-UHFFFAOYSA-N.
| Molecular formula | C16H18ClNO2 |
|---|---|
| Molecular weight | 291.77 g/mol |
| IUPAC name | benzyl 3-amino-2-phenylpropanoate;hydrochloride |
| InChIKey | JJJARRYOIJJCTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(CN)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)