CAS 1803585-29-6 appears in our catalog under these names: 2-(Chloromethyl)-1,3-benzothiazol-6-ol hydrochloride, 2-(Chloromethyl)-1,3-benzothiazol-6-ol hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(chloromethyl)-1,3-benzothiazol-6-ol;hydrochloride (CAS 1803585-29-6) is a chemical compound with the molecular formula C8H7Cl2NOS and a molecular weight of 236.12 g/mol. IUPAC name: 2-(chloromethyl)-1,3-benzothiazol-6-ol;hydrochloride. InChIKey: GHFDDBSLULFXDH-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NOS |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 2-(chloromethyl)-1,3-benzothiazol-6-ol;hydrochloride |
| InChIKey | GHFDDBSLULFXDH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)SC(=N2)CCl.Cl |
Computed by PubChem (NCBI)