Products 99254-21-4
CAS 99254-21-4 is the registry number for N-(2,5-Dichlorophenyl)-2-mercaptoacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(2,5-dichlorophenyl)-2-sulfanylacetamide (CAS 99254-21-4) is a chemical compound with the molecular formula C8H7Cl2NOS and a molecular weight of 236.12 g/mol. IUPAC name: N-(2,5-dichlorophenyl)-2-sulfanylacetamide. InChIKey: IGTBRTDEGAGICZ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NOS |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | N-(2,5-dichlorophenyl)-2-sulfanylacetamide |
| InChIKey | IGTBRTDEGAGICZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)NC(=O)CS)Cl |
Computed by PubChem (NCBI)