CAS 2302-32-1 is the registry number for 2-(2,4-Dichlorophenoxy)ethanethioamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2,4-dichlorophenoxy)ethanethioamide (CAS 2302-32-1) is a chemical compound with the molecular formula C8H7Cl2NOS and a molecular weight of 236.12 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)ethanethioamide. InChIKey: AGDXYFYNDRKKSF-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NOS |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)ethanethioamide |
| InChIKey | AGDXYFYNDRKKSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=S)N |
Computed by PubChem (NCBI)