Products 1803587-48-5
CAS 1803587-48-5 appears in our catalog under these names: 6-Fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-amine hydrochloride, 95%, 6-Fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1803587-48-5) is a chemical compound with the molecular formula C9H11ClFNO and a molecular weight of 203.64 g/mol. IUPAC name: 6-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: ZFVREFCCFHLCFG-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFNO |
|---|---|
| Molecular weight | 203.64 g/mol |
| IUPAC name | 6-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | ZFVREFCCFHLCFG-UHFFFAOYSA-N |
| SMILES | CC1C(C2=C(O1)C=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)