CAS 1803587-68-9 is the registry number for 4-(4-Chlorophenyl)-5-methyl-1H-1,2,3-triazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(4-chlorophenyl)-5-methyl-2H-triazole (CAS 1803587-68-9) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 4-(4-chlorophenyl)-5-methyl-2H-triazole. InChIKey: IIPOQCXWGRGHQM-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-5-methyl-2H-triazole |
| InChIKey | IIPOQCXWGRGHQM-UHFFFAOYSA-N |
| SMILES | CC1=NNN=C1C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)