Products 1803587-81-6
CAS 1803587-81-6 is the registry number for 2-Bromo-1-(2-methoxypyridin-3-yl)ethan-1-one hydrobromide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-bromo-1-(2-methoxy-3-pyridinyl)ethanone;hydrobromide (CAS 1803587-81-6) is a chemical compound with the molecular formula C8H9Br2NO2 and a molecular weight of 310.97 g/mol. IUPAC name: 2-bromo-1-(2-methoxy-3-pyridinyl)ethanone;hydrobromide. InChIKey: ALYKYHFFTUISBQ-UHFFFAOYSA-N.
| Molecular formula | C8H9Br2NO2 |
|---|---|
| Molecular weight | 310.97 g/mol |
| IUPAC name | 2-bromo-1-(2-methoxy-3-pyridinyl)ethanone;hydrobromide |
| InChIKey | ALYKYHFFTUISBQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=N1)C(=O)CBr.Br |
Computed by PubChem (NCBI)