CAS 2368871-68-3 appears in our catalog under these names: Methyl 3-(bromomethyl)isonicotinate hydrobromide, 95%, Methyl 3-(bromomethyl)isonicotinate hydrobromide 97%, Methyl 3-(bromomethyl)isonicotinate hydrobromide, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg.
Methyl 3-(bromomethyl)pyridine-4-carboxylate;hydrobromide (CAS 2368871-68-3) is a chemical compound with the molecular formula C8H9Br2NO2 and a molecular weight of 310.97 g/mol. IUPAC name: methyl 3-(bromomethyl)pyridine-4-carboxylate;hydrobromide. InChIKey: UYCHMPLGUUYYLY-UHFFFAOYSA-N.
| Molecular formula | C8H9Br2NO2 |
|---|---|
| Molecular weight | 310.97 g/mol |
| IUPAC name | methyl 3-(bromomethyl)pyridine-4-carboxylate;hydrobromide |
| InChIKey | UYCHMPLGUUYYLY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=NC=C1)CBr.Br |
Computed by PubChem (NCBI)