CAS 2442597-53-5 is the registry number for Methyl 4-(bromomethyl)nicotinate hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
Methyl 4-(bromomethyl)pyridine-3-carboxylate;hydrobromide (CAS 2442597-53-5) is a chemical compound with the molecular formula C8H9Br2NO2 and a molecular weight of 310.97 g/mol. IUPAC name: methyl 4-(bromomethyl)pyridine-3-carboxylate;hydrobromide. InChIKey: RKNWNFAKFWQIAR-UHFFFAOYSA-N.
| Molecular formula | C8H9Br2NO2 |
|---|---|
| Molecular weight | 310.97 g/mol |
| IUPAC name | methyl 4-(bromomethyl)pyridine-3-carboxylate;hydrobromide |
| InChIKey | RKNWNFAKFWQIAR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CN=C1)CBr.Br |
Computed by PubChem (NCBI)