CAS 1803588-83-1 appears in our catalog under these names: 1-(4-(Bromomethyl)phenyl)pyrrolidine hydrobromide, 1-(4-(Bromomethyl)phenyl)pyrrolidine hydrobromide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-[4-(bromomethyl)phenyl]pyrrolidine;hydrobromide (CAS 1803588-83-1) is a chemical compound with the molecular formula C11H15Br2N and a molecular weight of 321.05 g/mol. IUPAC name: 1-[4-(bromomethyl)phenyl]pyrrolidine;hydrobromide. InChIKey: WGTZAPPKWFXKLS-UHFFFAOYSA-N.
| Molecular formula | C11H15Br2N |
|---|---|
| Molecular weight | 321.05 g/mol |
| IUPAC name | 1-[4-(bromomethyl)phenyl]pyrrolidine;hydrobromide |
| InChIKey | WGTZAPPKWFXKLS-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC=C(C=C2)CBr.Br |
Computed by PubChem (NCBI)