CAS 1803589-49-2 appears in our catalog under these names: Sodium 2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepine-3-sulfonate, 95%, Sodium 2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepine-3-sulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 2-oxo-1,3,4,5-tetrahydro-1-benzazepine-3-sulfonate (CAS 1803589-49-2) is a chemical compound with the molecular formula C10H10NNaO4S and a molecular weight of 263.25 g/mol. IUPAC name: sodium 2-oxo-1,3,4,5-tetrahydro-1-benzazepine-3-sulfonate. InChIKey: DQBDSHIQNSQQIT-UHFFFAOYSA-M.
| Molecular formula | C10H10NNaO4S |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | sodium 2-oxo-1,3,4,5-tetrahydro-1-benzazepine-3-sulfonate |
| InChIKey | DQBDSHIQNSQQIT-UHFFFAOYSA-M |
| SMILES | C1CC2=CC=CC=C2NC(=O)C1S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)