CAS 20095-27-6 appears in our catalog under these names: Indole-3-acetaldehydesodiumbisulfiteadditioncompound, 97%, Sodium 1-Hydroxy-2-(1H-indol-3-yl)ethane-1-sulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 25mg, 0,5g, 50mg.
Sodium 1-hydroxy-2-(1H-indol-3-yl)ethanesulfonate (CAS 20095-27-6) is a chemical compound with the molecular formula C10H10NNaO4S and a molecular weight of 263.25 g/mol. IUPAC name: sodium 1-hydroxy-2-(1H-indol-3-yl)ethanesulfonate. InChIKey: WYKPCRCESPDDQX-UHFFFAOYSA-M.
| Molecular formula | C10H10NNaO4S |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | sodium 1-hydroxy-2-(1H-indol-3-yl)ethanesulfonate |
| InChIKey | WYKPCRCESPDDQX-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(O)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)