CAS 26807-69-2 is the registry number for Sodium 1-acetylindoline-2-sulfonate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 1-acetyl-2,3-dihydroindole-2-sulfonate (CAS 26807-69-2) is a chemical compound with the molecular formula C10H10NNaO4S and a molecular weight of 263.25 g/mol. IUPAC name: sodium 1-acetyl-2,3-dihydroindole-2-sulfonate. InChIKey: LKAZCMFZYBOAGI-UHFFFAOYSA-M.
| Molecular formula | C10H10NNaO4S |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | sodium 1-acetyl-2,3-dihydroindole-2-sulfonate |
| InChIKey | LKAZCMFZYBOAGI-UHFFFAOYSA-M |
| SMILES | CC(=O)N1C(CC2=CC=CC=C21)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)